C18H19Cl2N3O4S — CID 142627819
N-[2-(2,4-dichlorophenyl)-2-methoxyiminoethyl]-2-(methanesulfonamido)-2-phenylacetamide (PubChem CID 142627819) has the molecular formula C18H19Cl2N3O4S and a molecular weight of 444.34 g/mol. Its IUPAC name is N-[2-(2,4-dichlorophenyl)-2-methoxyiminoethyl]-2-(methanesulfonamido)-2-phenylacetamide.
| Compound Name | N-[2-(2,4-dichlorophenyl)-2-methoxyiminoethyl]-2-(methanesulfonamido)-2-phenylacetamide |
|---|---|
| PubChem CID | 142627819 |
| Molecular Formula | C18H19Cl2N3O4S |
| Molecular Weight | 444.34 g/mol |
| Exact Mass | 443.05 |
| IUPAC Name | N-[2-(2,4-dichlorophenyl)-2-methoxyiminoethyl]-2-(methanesulfonamido)-2-phenylacetamide |
| SMILES | CON=C(CNC(=O)C(NS(C)(=O)=O)c1ccccc1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H19Cl2N3O4S/c1-27-22-16(14-9-8-13(19)10-15(14)20)11-21-18(24)17(23-28(2,25)26)12-6-4-3-5-7-12/h3-10,17,23H,11H2,1-2H3,(H,21,24) |
| InChIKey | HGOWPGJVZNGMKF-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.34 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|