C24H26Cl4N4O4S2 — CID 155556271
(2E)-3-(2,4-dichlorophenyl)-N-[2-[2-[[(2E)-3-(2,4-dichlorophenyl)-2-methoxyiminopropanoyl]amino]ethyldisulfanyl]ethyl]-2-methoxyiminopropanamide (PubChem CID 155556271) has the molecular formula C24H26Cl4N4O4S2 and a molecular weight of 640.44 g/mol. Its IUPAC name is (2E)-3-(2,4-dichlorophenyl)-N-[2-[2-[[(2E)-3-(2,4-dichlorophenyl)-2-methoxyiminopropanoyl]amino]ethyldisulfanyl]ethyl]-2-methoxyiminopropanamide.
| Compound Name | (2E)-3-(2,4-dichlorophenyl)-N-[2-[2-[[(2E)-3-(2,4-dichlorophenyl)-2-methoxyiminopropanoyl]amino]ethyldisulfanyl]ethyl]-2-methoxyiminopropanamide |
|---|---|
| PubChem CID | 155556271 |
| Molecular Formula | C24H26Cl4N4O4S2 |
| Molecular Weight | 640.44 g/mol |
| Exact Mass | 638.01 |
| IUPAC Name | (2E)-3-(2,4-dichlorophenyl)-N-[2-[2-[[(2E)-3-(2,4-dichlorophenyl)-2-methoxyiminopropanoyl]amino]ethyldisulfanyl]ethyl]-2-methoxyiminopropanamide |
| SMILES | CO/N=C(\Cc1ccc(Cl)cc1Cl)C(=O)NCCSSCCNC(=O)/C(Cc1ccc(Cl)cc1Cl)=N/OC |
| InChI | InChI=1S/C24H26Cl4N4O4S2/c1-35-31-21(11-15-3-5-17(25)13-19(15)27)23(33)29-7-9-37-38-10-8-30-24(34)22(32-36-2)12-16-4-6-18(26)14-20(16)28/h3-6,13-14H,7-12H2,1-2H3,(H,29,33)(H,30,34)/b31-21+,32-22+ |
| InChIKey | XSMVMQYYSMFKPY-RWRHWQIFSA-N |
| XLogP | 5.70 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.44 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|