C15H22Cl2N2O6S — CID 142627842
N-[2-(2,4-dichlorophenyl)-2,2-dimethoxyethyl]-3-hydroxy-2-(methanesulfonamido)butanamide (PubChem CID 142627842) has the molecular formula C15H22Cl2N2O6S and a molecular weight of 429.32 g/mol. Its IUPAC name is N-[2-(2,4-dichlorophenyl)-2,2-dimethoxyethyl]-3-hydroxy-2-(methanesulfonamido)butanamide.
| Compound Name | N-[2-(2,4-dichlorophenyl)-2,2-dimethoxyethyl]-3-hydroxy-2-(methanesulfonamido)butanamide |
|---|---|
| PubChem CID | 142627842 |
| Molecular Formula | C15H22Cl2N2O6S |
| Molecular Weight | 429.32 g/mol |
| Exact Mass | 428.06 |
| IUPAC Name | N-[2-(2,4-dichlorophenyl)-2,2-dimethoxyethyl]-3-hydroxy-2-(methanesulfonamido)butanamide |
| SMILES | COC(CNC(=O)C(NS(C)(=O)=O)C(C)O)(OC)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H22Cl2N2O6S/c1-9(20)13(19-26(4,22)23)14(21)18-8-15(24-2,25-3)11-6-5-10(16)7-12(11)17/h5-7,9,13,19-20H,8H2,1-4H3,(H,18,21) |
| InChIKey | SFLKSCGMTVGFDC-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.32 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|