C20H22F3NO3 — CID 142629545
N-[1-(2-ethyl-4-hydroxy-6-methylphenoxy)propyl]-3-(trifluoromethyl)benzamide (PubChem CID 142629545) has the molecular formula C20H22F3NO3 and a molecular weight of 381.39 g/mol. Its IUPAC name is N-[1-(2-ethyl-4-hydroxy-6-methylphenoxy)propyl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[1-(2-ethyl-4-hydroxy-6-methylphenoxy)propyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 142629545 |
| Molecular Formula | C20H22F3NO3 |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | N-[1-(2-ethyl-4-hydroxy-6-methylphenoxy)propyl]-3-(trifluoromethyl)benzamide |
| SMILES | CCc1cc(O)cc(C)c1OC(CC)NC(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H22F3NO3/c1-4-13-11-16(25)9-12(3)18(13)27-17(5-2)24-19(26)14-7-6-8-15(10-14)20(21,22)23/h6-11,17,25H,4-5H2,1-3H3,(H,24,26) |
| InChIKey | QUQTVQXHGZTPME-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|