C8H17O+ — CID 142629566
1,2,2-trimethyloxan-1-ium (PubChem CID 142629566) has the molecular formula C8H17O+ and a molecular weight of 129.22 g/mol. Its IUPAC name is 1,2,2-trimethyloxan-1-ium.
| Compound Name | 1,2,2-trimethyloxan-1-ium |
|---|---|
| PubChem CID | 142629566 |
| Molecular Formula | C8H17O+ |
| Molecular Weight | 129.22 g/mol |
| Exact Mass | 129.13 |
| IUPAC Name | 1,2,2-trimethyloxan-1-ium |
| SMILES | C[O+]1CCCCC1(C)C |
| InChI | InChI=1S/C8H17O/c1-8(2)6-4-5-7-9(8)3/h4-7H2,1-3H3/q+1 |
| InChIKey | UBTOFEDLHMWHTD-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 2.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.22 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|