C18H24N2O3 — CID 142630502
1-butyl-6-(3,5-dimethylphenoxy)-5-ethylpyrimidine-2,4-dione (PubChem CID 142630502) has the molecular formula C18H24N2O3 and a molecular weight of 316.40 g/mol. Its IUPAC name is 1-butyl-6-(3,5-dimethylphenoxy)-5-ethylpyrimidine-2,4-dione.
| Compound Name | 1-butyl-6-(3,5-dimethylphenoxy)-5-ethylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 142630502 |
| Molecular Formula | C18H24N2O3 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | 1-butyl-6-(3,5-dimethylphenoxy)-5-ethylpyrimidine-2,4-dione |
| SMILES | CCCCn1c(Oc2cc(C)cc(C)c2)c(CC)c(=O)[nH]c1=O |
| InChI | InChI=1S/C18H24N2O3/c1-5-7-8-20-17(15(6-2)16(21)19-18(20)22)23-14-10-12(3)9-13(4)11-14/h9-11H,5-8H2,1-4H3,(H,19,21,22) |
| InChIKey | AVLQFHGDTVNLTP-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |