C7H12N4O — CID 142630694
2-[3-(1,2-oxazol-3-yl)propyl]guanidine (PubChem CID 142630694) has the molecular formula C7H12N4O and a molecular weight of 168.20 g/mol. Its IUPAC name is 2-[3-(1,2-oxazol-3-yl)propyl]guanidine.
| Compound Name | 2-[3-(1,2-oxazol-3-yl)propyl]guanidine |
|---|---|
| PubChem CID | 142630694 |
| Molecular Formula | C7H12N4O |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.10 |
| IUPAC Name | 2-[3-(1,2-oxazol-3-yl)propyl]guanidine |
| SMILES | NC(N)=NCCCc1ccon1 |
| InChI | InChI=1S/C7H12N4O/c8-7(9)10-4-1-2-6-3-5-12-11-6/h3,5H,1-2,4H2,(H4,8,9,10) |
| InChIKey | MGMYEXLXUOQBKY-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 90.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|