C24H27N5O4S — CID 142630750
3-amino-5-[[(3S)-3-[(7-methoxynaphthalen-2-yl)sulfonylmethylamino]-2-oxopyrrolidin-1-yl]methyl]benzenecarboximidamide (PubChem CID 142630750) has the molecular formula C24H27N5O4S and a molecular weight of 481.58 g/mol. Its IUPAC name is 3-amino-5-[[(3S)-3-[(7-methoxynaphthalen-2-yl)sulfonylmethylamino]-2-oxopyrrolidin-1-yl]methyl]benzenecarboximidamide.
| Compound Name | 3-amino-5-[[(3S)-3-[(7-methoxynaphthalen-2-yl)sulfonylmethylamino]-2-oxopyrrolidin-1-yl]methyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 142630750 |
| Molecular Formula | C24H27N5O4S |
| Molecular Weight | 481.58 g/mol |
| Exact Mass | 481.18 |
| IUPAC Name | 3-amino-5-[[(3S)-3-[(7-methoxynaphthalen-2-yl)sulfonylmethylamino]-2-oxopyrrolidin-1-yl]methyl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cc(N)cc(CN2CC[C@H](NCS(=O)(=O)c3ccc4ccc(OC)cc4c3)C2=O)c1 |
| InChI | InChI=1S/C24H27N5O4S/c1-33-20-4-2-16-3-5-21(12-17(16)11-20)34(31,32)14-28-22-6-7-29(24(22)30)13-15-8-18(23(26)27)10-19(25)9-15/h2-5,8-12,22,28H,6-7,13-14,25H2,1H3,(H3,26,27)/t22-/m0/s1 |
| InChIKey | NCXXOADFBPZAIX-QFIPXVFZSA-N |
| XLogP | 1.84 |
| TPSA | 151.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.58 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|