C15H21Cl2N3O4 — CID 142632404
tert-butyl N-[1-[2-(2,5-dichlorophenyl)hydrazinyl]-3-hydroxy-1-oxobutan-2-yl]carbamate (PubChem CID 142632404) has the molecular formula C15H21Cl2N3O4 and a molecular weight of 378.26 g/mol. Its IUPAC name is tert-butyl N-[1-[2-(2,5-dichlorophenyl)hydrazinyl]-3-hydroxy-1-oxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[2-(2,5-dichlorophenyl)hydrazinyl]-3-hydroxy-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 142632404 |
| Molecular Formula | C15H21Cl2N3O4 |
| Molecular Weight | 378.26 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | tert-butyl N-[1-[2-(2,5-dichlorophenyl)hydrazinyl]-3-hydroxy-1-oxobutan-2-yl]carbamate |
| SMILES | CC(O)C(NC(=O)OC(C)(C)C)C(=O)NNc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C15H21Cl2N3O4/c1-8(21)12(18-14(23)24-15(2,3)4)13(22)20-19-11-7-9(16)5-6-10(11)17/h5-8,12,19,21H,1-4H3,(H,18,23)(H,20,22) |
| InChIKey | GUGZICJDUJVHJA-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.26 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|