C21H29NO3S — CID 142633265
N-(3,5-dibutyl-4-hydroxyphenyl)-4-methylbenzenesulfonamide (PubChem CID 142633265) has the molecular formula C21H29NO3S and a molecular weight of 375.53 g/mol. Its IUPAC name is N-(3,5-dibutyl-4-hydroxyphenyl)-4-methylbenzenesulfonamide.
| Compound Name | N-(3,5-dibutyl-4-hydroxyphenyl)-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 142633265 |
| Molecular Formula | C21H29NO3S |
| Molecular Weight | 375.53 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | N-(3,5-dibutyl-4-hydroxyphenyl)-4-methylbenzenesulfonamide |
| SMILES | CCCCc1cc(NS(=O)(=O)c2ccc(C)cc2)cc(CCCC)c1O |
| InChI | InChI=1S/C21H29NO3S/c1-4-6-8-17-14-19(15-18(21(17)23)9-7-5-2)22-26(24,25)20-12-10-16(3)11-13-20/h10-15,22-23H,4-9H2,1-3H3 |
| InChIKey | UQUSGZAIAXJJFJ-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.53 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|