C14H19N5O — CID 142633393
2-imidazol-1-yl-N-(2-methoxyethyl)-1,5,6,7-tetrahydroquinazolin-4-amine (PubChem CID 142633393) has the molecular formula C14H19N5O and a molecular weight of 273.34 g/mol. Its IUPAC name is 2-imidazol-1-yl-N-(2-methoxyethyl)-1,5,6,7-tetrahydroquinazolin-4-amine.
| Compound Name | 2-imidazol-1-yl-N-(2-methoxyethyl)-1,5,6,7-tetrahydroquinazolin-4-amine |
|---|---|
| PubChem CID | 142633393 |
| Molecular Formula | C14H19N5O |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.16 |
| IUPAC Name | 2-imidazol-1-yl-N-(2-methoxyethyl)-1,5,6,7-tetrahydroquinazolin-4-amine |
| SMILES | COCCNC1=C2CCCC=C2NC(n2ccnc2)=N1 |
| InChI | InChI=1S/C14H19N5O/c1-20-9-7-16-13-11-4-2-3-5-12(11)17-14(18-13)19-8-6-15-10-19/h5-6,8,10,16H,2-4,7,9H2,1H3,(H,17,18) |
| InChIKey | IIVDQGPFIJYJMY-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|