C20H28N4 — CID 143546587
N-(3-imidazol-1-ylpropyl)-4-[(1E,3Z)-3-[(Z)-2-(methylamino)ethenyl]penta-1,3-dienyl]cyclohexa-1,3-dien-1-amine (PubChem CID 143546587) has the molecular formula C20H28N4 and a molecular weight of 324.47 g/mol. Its IUPAC name is N-(3-imidazol-1-ylpropyl)-4-[(1E,3Z)-3-[(Z)-2-(methylamino)ethenyl]penta-1,3-dienyl]cyclohexa-1,3-dien-1-amine.
| Compound Name | N-(3-imidazol-1-ylpropyl)-4-[(1E,3Z)-3-[(Z)-2-(methylamino)ethenyl]penta-1,3-dienyl]cyclohexa-1,3-dien-1-amine |
|---|---|
| PubChem CID | 143546587 |
| Molecular Formula | C20H28N4 |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.23 |
| IUPAC Name | N-(3-imidazol-1-ylpropyl)-4-[(1E,3Z)-3-[(Z)-2-(methylamino)ethenyl]penta-1,3-dienyl]cyclohexa-1,3-dien-1-amine |
| SMILES | C/C=C(\C=C/NC)/C=C/C1=CC=C(NCCCn2ccnc2)CC1 |
| InChI | InChI=1S/C20H28N4/c1-3-18(11-13-21-2)5-6-19-7-9-20(10-8-19)23-12-4-15-24-16-14-22-17-24/h3,5-7,9,11,13-14,16-17,21,23H,4,8,10,12,15H2,1-2H3/b6-5+,13-11-,18-3- |
| InChIKey | MONJVYVJSHCWBB-UTFVOOIVSA-N |
| XLogP | 3.70 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|