C17H30O2 — CID 142633658
(6Z)-1,4-dioxaspiro[4.14]nonadec-6-ene (PubChem CID 142633658) has the molecular formula C17H30O2 and a molecular weight of 266.42 g/mol. Its IUPAC name is (6Z)-1,4-dioxaspiro[4.14]nonadec-6-ene.
| Compound Name | (6Z)-1,4-dioxaspiro[4.14]nonadec-6-ene |
|---|---|
| PubChem CID | 142633658 |
| Molecular Formula | C17H30O2 |
| Molecular Weight | 266.42 g/mol |
| Exact Mass | 266.22 |
| IUPAC Name | (6Z)-1,4-dioxaspiro[4.14]nonadec-6-ene |
| SMILES | C1=C\C2(CCCCCCCCCCCC/1)OCCO2 |
| InChI | InChI=1S/C17H30O2/c1-2-4-6-8-10-12-14-17(18-15-16-19-17)13-11-9-7-5-3-1/h11,13H,1-10,12,14-16H2/b13-11- |
| InChIKey | ROAZPXQTDYQRHI-QBFSEMIESA-N |
| XLogP | 4.98 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.42 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|