C17H24N4O — CID 142635933
1-[4-[(2-ethyl-7-methyl-3H-benzimidazol-5-yl)oxy]piperidin-1-yl]ethanimine (PubChem CID 142635933) has the molecular formula C17H24N4O and a molecular weight of 300.41 g/mol. Its IUPAC name is 1-[4-[(2-ethyl-7-methyl-3H-benzimidazol-5-yl)oxy]piperidin-1-yl]ethanimine.
| Compound Name | 1-[4-[(2-ethyl-7-methyl-3H-benzimidazol-5-yl)oxy]piperidin-1-yl]ethanimine |
|---|---|
| PubChem CID | 142635933 |
| Molecular Formula | C17H24N4O |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.20 |
| IUPAC Name | 1-[4-[(2-ethyl-7-methyl-3H-benzimidazol-5-yl)oxy]piperidin-1-yl]ethanimine |
| SMILES | [H]/N=C(\C)N1CCC(Oc2cc(C)c3nc(CC)[nH]c3c2)CC1 |
| InChI | InChI=1S/C17H24N4O/c1-4-16-19-15-10-14(9-11(2)17(15)20-16)22-13-5-7-21(8-6-13)12(3)18/h9-10,13,18H,4-8H2,1-3H3,(H,19,20)/b18-12+ |
| InChIKey | OYMNVBOFPHYKHL-LDADJPATSA-N |
| XLogP | 3.27 |
| TPSA | 65.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|