C19H27N5O3 — CID 142635871
2-[[6-(1-ethanimidoylpiperidin-4-yl)oxy-2,4-dimethyl-1H-benzimidazol-5-yl]oxy]propanamide (PubChem CID 142635871) has the molecular formula C19H27N5O3 and a molecular weight of 373.46 g/mol. Its IUPAC name is 2-[[6-(1-ethanimidoylpiperidin-4-yl)oxy-2,4-dimethyl-1H-benzimidazol-5-yl]oxy]propanamide.
| Compound Name | 2-[[6-(1-ethanimidoylpiperidin-4-yl)oxy-2,4-dimethyl-1H-benzimidazol-5-yl]oxy]propanamide |
|---|---|
| PubChem CID | 142635871 |
| Molecular Formula | C19H27N5O3 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.21 |
| IUPAC Name | 2-[[6-(1-ethanimidoylpiperidin-4-yl)oxy-2,4-dimethyl-1H-benzimidazol-5-yl]oxy]propanamide |
| SMILES | [H]/N=C(\C)N1CCC(Oc2cc3[nH]c(C)nc3c(C)c2OC(C)C(N)=O)CC1 |
| InChI | InChI=1S/C19H27N5O3/c1-10-17-15(22-13(4)23-17)9-16(18(10)26-11(2)19(21)25)27-14-5-7-24(8-6-14)12(3)20/h9,11,14,20H,5-8H2,1-4H3,(H2,21,25)(H,22,23)/b20-12+ |
| InChIKey | AHSVNTKIMURIAC-UDWIEESQSA-N |
| XLogP | 2.27 |
| TPSA | 117.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|