C17H15ClN2O2 — CID 142636695
2-[7-[(2-chlorophenyl)methyl]-2-methyl-3H-benzimidazol-5-yl]acetic acid (PubChem CID 142636695) has the molecular formula C17H15ClN2O2 and a molecular weight of 314.77 g/mol. Its IUPAC name is 2-[7-[(2-chlorophenyl)methyl]-2-methyl-3H-benzimidazol-5-yl]acetic acid.
| Compound Name | 2-[7-[(2-chlorophenyl)methyl]-2-methyl-3H-benzimidazol-5-yl]acetic acid |
|---|---|
| PubChem CID | 142636695 |
| Molecular Formula | C17H15ClN2O2 |
| Molecular Weight | 314.77 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | 2-[7-[(2-chlorophenyl)methyl]-2-methyl-3H-benzimidazol-5-yl]acetic acid |
| SMILES | Cc1nc2c(Cc3ccccc3Cl)cc(CC(=O)O)cc2[nH]1 |
| InChI | InChI=1S/C17H15ClN2O2/c1-10-19-15-7-11(8-16(21)22)6-13(17(15)20-10)9-12-4-2-3-5-14(12)18/h2-7H,8-9H2,1H3,(H,19,20)(H,21,22) |
| InChIKey | GVSOGOZYCCCSCP-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.77 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |