C11H9Cl3N2 — CID 142636907
4-(2-chlorophenyl)-5-(1,1-dichloroethyl)-1H-pyrazole (PubChem CID 142636907) has the molecular formula C11H9Cl3N2 and a molecular weight of 275.57 g/mol. Its IUPAC name is 4-(2-chlorophenyl)-5-(1,1-dichloroethyl)-1H-pyrazole.
| Compound Name | 4-(2-chlorophenyl)-5-(1,1-dichloroethyl)-1H-pyrazole |
|---|---|
| PubChem CID | 142636907 |
| Molecular Formula | C11H9Cl3N2 |
| Molecular Weight | 275.57 g/mol |
| Exact Mass | 273.98 |
| IUPAC Name | 4-(2-chlorophenyl)-5-(1,1-dichloroethyl)-1H-pyrazole |
| SMILES | CC(Cl)(Cl)c1[nH]ncc1-c1ccccc1Cl |
| InChI | InChI=1S/C11H9Cl3N2/c1-11(13,14)10-8(6-15-16-10)7-4-2-3-5-9(7)12/h2-6H,1H3,(H,15,16) |
| InChIKey | ZINHIWYWVDNPFL-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.57 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|