C23H38N4O4 — CID 142638191
1-[2-oxo-3-(1-piperidin-4-ylpiperidin-4-yl)-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-7-yl]piperidine-4-carboxylic acid (PubChem CID 142638191) has the molecular formula C23H38N4O4 and a molecular weight of 434.58 g/mol. Its IUPAC name is 1-[2-oxo-3-(1-piperidin-4-ylpiperidin-4-yl)-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-7-yl]piperidine-4-carboxylic acid.
| Compound Name | 1-[2-oxo-3-(1-piperidin-4-ylpiperidin-4-yl)-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-7-yl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 142638191 |
| Molecular Formula | C23H38N4O4 |
| Molecular Weight | 434.58 g/mol |
| Exact Mass | 434.29 |
| IUPAC Name | 1-[2-oxo-3-(1-piperidin-4-ylpiperidin-4-yl)-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-7-yl]piperidine-4-carboxylic acid |
| SMILES | O=C(O)C1CCN(C2CCCC3C2OC(=O)N3C2CCN(C3CCNCC3)CC2)CC1 |
| InChI | InChI=1S/C23H38N4O4/c28-22(29)16-6-12-26(13-7-16)19-2-1-3-20-21(19)31-23(30)27(20)18-8-14-25(15-9-18)17-4-10-24-11-5-17/h16-21,24H,1-15H2,(H,28,29) |
| InChIKey | HFNCSDKONRCGHK-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 85.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.58 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |