C31H40O8 — CID 142638277
phenyl 1,4-bis(6-prop-2-enoyloxyhexoxy)cyclohexa-2,4-diene-1-carboxylate (PubChem CID 142638277) has the molecular formula C31H40O8 and a molecular weight of 540.65 g/mol. Its IUPAC name is phenyl 1,4-bis(6-prop-2-enoyloxyhexoxy)cyclohexa-2,4-diene-1-carboxylate.
| Compound Name | phenyl 1,4-bis(6-prop-2-enoyloxyhexoxy)cyclohexa-2,4-diene-1-carboxylate |
|---|---|
| PubChem CID | 142638277 |
| Molecular Formula | C31H40O8 |
| Molecular Weight | 540.65 g/mol |
| Exact Mass | 540.27 |
| IUPAC Name | phenyl 1,4-bis(6-prop-2-enoyloxyhexoxy)cyclohexa-2,4-diene-1-carboxylate |
| SMILES | C=CC(=O)OCCCCCCOC1=CCC(OCCCCCCOC(=O)C=C)(C(=O)Oc2ccccc2)C=C1 |
| InChI | InChI=1S/C31H40O8/c1-3-28(32)36-23-13-6-5-12-22-35-26-18-20-31(21-19-26,30(34)39-27-16-10-9-11-17-27)38-25-15-8-7-14-24-37-29(33)4-2/h3-4,9-11,16-20H,1-2,5-8,12-15,21-25H2 |
| InChIKey | YYEATOPZOPQEML-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.65 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|