C26H37N3O2 — CID 142638309
1'-cyclodecyl-5-phenylspiro[6,6a-dihydro-3aH-pyrrolo[3,4-c]pyrrole-4,4'-piperidine]-1,3-dione (PubChem CID 142638309) has the molecular formula C26H37N3O2 and a molecular weight of 423.60 g/mol. Its IUPAC name is 1'-cyclodecyl-5-phenylspiro[6,6a-dihydro-3aH-pyrrolo[3,4-c]pyrrole-4,4'-piperidine]-1,3-dione.
| Compound Name | 1'-cyclodecyl-5-phenylspiro[6,6a-dihydro-3aH-pyrrolo[3,4-c]pyrrole-4,4'-piperidine]-1,3-dione |
|---|---|
| PubChem CID | 142638309 |
| Molecular Formula | C26H37N3O2 |
| Molecular Weight | 423.60 g/mol |
| Exact Mass | 423.29 |
| IUPAC Name | 1'-cyclodecyl-5-phenylspiro[6,6a-dihydro-3aH-pyrrolo[3,4-c]pyrrole-4,4'-piperidine]-1,3-dione |
| SMILES | O=C1NC(=O)C2C1CN(c1ccccc1)C21CCN(C2CCCCCCCCC2)CC1 |
| InChI | InChI=1S/C26H37N3O2/c30-24-22-19-29(21-13-9-6-10-14-21)26(23(22)25(31)27-24)15-17-28(18-16-26)20-11-7-4-2-1-3-5-8-12-20/h6,9-10,13-14,20,22-23H,1-5,7-8,11-12,15-19H2,(H,27,30,31) |
| InChIKey | RRFIQOPTXACSST-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.60 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|