C19H15F3N2O2 — CID 134961612
(3R,3aR,6aS)-3,5-diphenyl-3-(trifluoromethyl)-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-4,6-dione (PubChem CID 134961612) has the molecular formula C19H15F3N2O2 and a molecular weight of 360.34 g/mol. Its IUPAC name is (3R,3aR,6aS)-3,5-diphenyl-3-(trifluoromethyl)-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-4,6-dione.
| Compound Name | (3R,3aR,6aS)-3,5-diphenyl-3-(trifluoromethyl)-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-4,6-dione |
|---|---|
| PubChem CID | 134961612 |
| Molecular Formula | C19H15F3N2O2 |
| Molecular Weight | 360.34 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | (3R,3aR,6aS)-3,5-diphenyl-3-(trifluoromethyl)-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-4,6-dione |
| SMILES | O=C1[C@@H]2[C@@H](CN[C@]2(c2ccccc2)C(F)(F)F)C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C19H15F3N2O2/c20-19(21,22)18(12-7-3-1-4-8-12)15-14(11-23-18)16(25)24(17(15)26)13-9-5-2-6-10-13/h1-10,14-15,23H,11H2/t14-,15+,18+/m1/s1 |
| InChIKey | SIFLHAFEFBFNON-VKJFTORMSA-N |
| XLogP | 2.85 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.34 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|