C41H41FO5S — CID 142641925
methyl 2-[5-[3-[2-ethyl-4-(4-fluorophenyl)-5-phenylmethoxyphenoxy]propoxy]-5-prop-1-enylcyclohexa-1,3-dien-1-yl]sulfanylbenzoate (PubChem CID 142641925) has the molecular formula C41H41FO5S and a molecular weight of 664.84 g/mol. Its IUPAC name is methyl 2-[5-[3-[2-ethyl-4-(4-fluorophenyl)-5-phenylmethoxyphenoxy]propoxy]-5-prop-1-enylcyclohexa-1,3-dien-1-yl]sulfanylbenzoate.
| Compound Name | methyl 2-[5-[3-[2-ethyl-4-(4-fluorophenyl)-5-phenylmethoxyphenoxy]propoxy]-5-prop-1-enylcyclohexa-1,3-dien-1-yl]sulfanylbenzoate |
|---|---|
| PubChem CID | 142641925 |
| Molecular Formula | C41H41FO5S |
| Molecular Weight | 664.84 g/mol |
| Exact Mass | 664.27 |
| IUPAC Name | methyl 2-[5-[3-[2-ethyl-4-(4-fluorophenyl)-5-phenylmethoxyphenoxy]propoxy]-5-prop-1-enylcyclohexa-1,3-dien-1-yl]sulfanylbenzoate |
| SMILES | CC=CC1(OCCCOc2cc(OCc3ccccc3)c(-c3ccc(F)cc3)cc2CC)C=CC=C(Sc2ccccc2C(=O)OC)C1 |
| InChI | InChI=1S/C41H41FO5S/c1-4-22-41(23-11-15-34(28-41)48-39-17-10-9-16-35(39)40(43)44-3)47-25-12-24-45-37-27-38(46-29-30-13-7-6-8-14-30)36(26-31(37)5-2)32-18-20-33(42)21-19-32/h4,6-11,13-23,26-27H,5,12,24-25,28-29H2,1-3H3 |
| InChIKey | RYODZBJSPVKGSZ-UHFFFAOYSA-N |
| XLogP | 10.16 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.84 |
| LogP ≤ 5 | 10.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|