C18H16INO4 — CID 142644057
5-(iodomethyl)-3-[4-(2-methoxy-5-oxocyclohepta-1,3,6-trien-1-yl)phenyl]-1,3-oxazolidin-2-one (PubChem CID 142644057) has the molecular formula C18H16INO4 and a molecular weight of 437.23 g/mol. Its IUPAC name is 5-(iodomethyl)-3-[4-(2-methoxy-5-oxocyclohepta-1,3,6-trien-1-yl)phenyl]-1,3-oxazolidin-2-one.
| Compound Name | 5-(iodomethyl)-3-[4-(2-methoxy-5-oxocyclohepta-1,3,6-trien-1-yl)phenyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 142644057 |
| Molecular Formula | C18H16INO4 |
| Molecular Weight | 437.23 g/mol |
| Exact Mass | 437.01 |
| IUPAC Name | 5-(iodomethyl)-3-[4-(2-methoxy-5-oxocyclohepta-1,3,6-trien-1-yl)phenyl]-1,3-oxazolidin-2-one |
| SMILES | COc1ccc(=O)ccc1-c1ccc(N2CC(CI)OC2=O)cc1 |
| InChI | InChI=1S/C18H16INO4/c1-23-17-9-7-14(21)6-8-16(17)12-2-4-13(5-3-12)20-11-15(10-19)24-18(20)22/h2-9,15H,10-11H2,1H3 |
| InChIKey | GATIFDSFYZYCSG-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.23 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|