C20H24N4O11 — CID 142646447
butyl [4-(1-carboxyoxyethyl)-5-(4,5-dimethoxy-2-nitrobenzoyl)triazol-2-yl]methyl carbonate (PubChem CID 142646447) has the molecular formula C20H24N4O11 and a molecular weight of 496.43 g/mol. Its IUPAC name is butyl [4-(1-carboxyoxyethyl)-5-(4,5-dimethoxy-2-nitrobenzoyl)triazol-2-yl]methyl carbonate.
| Compound Name | butyl [4-(1-carboxyoxyethyl)-5-(4,5-dimethoxy-2-nitrobenzoyl)triazol-2-yl]methyl carbonate |
|---|---|
| PubChem CID | 142646447 |
| Molecular Formula | C20H24N4O11 |
| Molecular Weight | 496.43 g/mol |
| Exact Mass | 496.14 |
| IUPAC Name | butyl [4-(1-carboxyoxyethyl)-5-(4,5-dimethoxy-2-nitrobenzoyl)triazol-2-yl]methyl carbonate |
| SMILES | CCCCOC(=O)OCn1nc(C(=O)c2cc(OC)c(OC)cc2[N+](=O)[O-])c(C(C)OC(=O)O)n1 |
| InChI | InChI=1S/C20H24N4O11/c1-5-6-7-33-20(28)34-10-23-21-16(11(2)35-19(26)27)17(22-23)18(25)12-8-14(31-3)15(32-4)9-13(12)24(29)30/h8-9,11H,5-7,10H2,1-4H3,(H,26,27) |
| InChIKey | HVFYRRPUXPPAHS-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 191.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.43 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|