C15H16N4O9 — CID 142646426
1-[5-(4,5-dimethoxy-2-nitrobenzoyl)-2-(hydroxymethyl)triazol-4-yl]ethyl hydrogen carbonate (PubChem CID 142646426) has the molecular formula C15H16N4O9 and a molecular weight of 396.31 g/mol. Its IUPAC name is 1-[5-(4,5-dimethoxy-2-nitrobenzoyl)-2-(hydroxymethyl)triazol-4-yl]ethyl hydrogen carbonate.
| Compound Name | 1-[5-(4,5-dimethoxy-2-nitrobenzoyl)-2-(hydroxymethyl)triazol-4-yl]ethyl hydrogen carbonate |
|---|---|
| PubChem CID | 142646426 |
| Molecular Formula | C15H16N4O9 |
| Molecular Weight | 396.31 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | 1-[5-(4,5-dimethoxy-2-nitrobenzoyl)-2-(hydroxymethyl)triazol-4-yl]ethyl hydrogen carbonate |
| SMILES | COc1cc(C(=O)c2nn(CO)nc2C(C)OC(=O)O)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C15H16N4O9/c1-7(28-15(22)23)12-13(17-18(6-20)16-12)14(21)8-4-10(26-2)11(27-3)5-9(8)19(24)25/h4-5,7,20H,6H2,1-3H3,(H,22,23) |
| InChIKey | VPZNBAHDAFSYJF-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 176.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.31 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|