C18H20N4O10 — CID 142646397
propan-2-yl 4-(1-carboxyoxyethyl)-5-(4,5-dimethoxy-2-nitrobenzoyl)triazole-2-carboxylate (PubChem CID 142646397) has the molecular formula C18H20N4O10 and a molecular weight of 452.38 g/mol. Its IUPAC name is propan-2-yl 4-(1-carboxyoxyethyl)-5-(4,5-dimethoxy-2-nitrobenzoyl)triazole-2-carboxylate.
| Compound Name | propan-2-yl 4-(1-carboxyoxyethyl)-5-(4,5-dimethoxy-2-nitrobenzoyl)triazole-2-carboxylate |
|---|---|
| PubChem CID | 142646397 |
| Molecular Formula | C18H20N4O10 |
| Molecular Weight | 452.38 g/mol |
| Exact Mass | 452.12 |
| IUPAC Name | propan-2-yl 4-(1-carboxyoxyethyl)-5-(4,5-dimethoxy-2-nitrobenzoyl)triazole-2-carboxylate |
| SMILES | COc1cc(C(=O)c2nn(C(=O)OC(C)C)nc2C(C)OC(=O)O)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C18H20N4O10/c1-8(2)31-17(24)21-19-14(9(3)32-18(25)26)15(20-21)16(23)10-6-12(29-4)13(30-5)7-11(10)22(27)28/h6-9H,1-5H3,(H,25,26) |
| InChIKey | NSHFXVDXTUDPBB-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 182.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.38 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|