C19H23FN4O3 — CID 142647369
[4-[[4-(3-fluoro-2-pyridinyl)piperazin-1-yl]methyl]phenoxy]methyl N-methylcarbamate (PubChem CID 142647369) has the molecular formula C19H23FN4O3 and a molecular weight of 374.42 g/mol. Its IUPAC name is [4-[[4-(3-fluoro-2-pyridinyl)piperazin-1-yl]methyl]phenoxy]methyl N-methylcarbamate.
| Compound Name | [4-[[4-(3-fluoro-2-pyridinyl)piperazin-1-yl]methyl]phenoxy]methyl N-methylcarbamate |
|---|---|
| PubChem CID | 142647369 |
| Molecular Formula | C19H23FN4O3 |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | [4-[[4-(3-fluoro-2-pyridinyl)piperazin-1-yl]methyl]phenoxy]methyl N-methylcarbamate |
| SMILES | CNC(=O)OCOc1ccc(CN2CCN(c3ncccc3F)CC2)cc1 |
| InChI | InChI=1S/C19H23FN4O3/c1-21-19(25)27-14-26-16-6-4-15(5-7-16)13-23-9-11-24(12-10-23)18-17(20)3-2-8-22-18/h2-8H,9-14H2,1H3,(H,21,25) |
| InChIKey | AHWWWNFLZHLKJJ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 66.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|