C10H14N2O3 — CID 142648861
3-amino-4-(cyclopentylmethoxyamino)cyclobut-3-ene-1,2-dione (PubChem CID 142648861) has the molecular formula C10H14N2O3 and a molecular weight of 210.23 g/mol. Its IUPAC name is 3-amino-4-(cyclopentylmethoxyamino)cyclobut-3-ene-1,2-dione.
| Compound Name | 3-amino-4-(cyclopentylmethoxyamino)cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 142648861 |
| Molecular Formula | C10H14N2O3 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | 3-amino-4-(cyclopentylmethoxyamino)cyclobut-3-ene-1,2-dione |
| SMILES | Nc1c(NOCC2CCCC2)c(=O)c1=O |
| InChI | InChI=1S/C10H14N2O3/c11-7-8(10(14)9(7)13)12-15-5-6-3-1-2-4-6/h6,12H,1-5,11H2 |
| InChIKey | FKUZHNBOFLDRSS-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|