C25H33N3O3 — CID 142650656
N-[3-hydroxy-1-[2-(3-pyridin-2-ylphenyl)acetyl]azepan-4-yl]-4-methylpentanamide (PubChem CID 142650656) has the molecular formula C25H33N3O3 and a molecular weight of 423.56 g/mol. Its IUPAC name is N-[3-hydroxy-1-[2-(3-pyridin-2-ylphenyl)acetyl]azepan-4-yl]-4-methylpentanamide.
| Compound Name | N-[3-hydroxy-1-[2-(3-pyridin-2-ylphenyl)acetyl]azepan-4-yl]-4-methylpentanamide |
|---|---|
| PubChem CID | 142650656 |
| Molecular Formula | C25H33N3O3 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.25 |
| IUPAC Name | N-[3-hydroxy-1-[2-(3-pyridin-2-ylphenyl)acetyl]azepan-4-yl]-4-methylpentanamide |
| SMILES | CC(C)CCC(=O)NC1CCCN(C(=O)Cc2cccc(-c3ccccn3)c2)CC1O |
| InChI | InChI=1S/C25H33N3O3/c1-18(2)11-12-24(30)27-22-10-6-14-28(17-23(22)29)25(31)16-19-7-5-8-20(15-19)21-9-3-4-13-26-21/h3-5,7-9,13,15,18,22-23,29H,6,10-12,14,16-17H2,1-2H3,(H,27,30) |
| InChIKey | YJLYPOSDLHNMGR-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |