C26H36N4O4 — CID 69309720
[(3S)-5-[[3-hydroxy-1-[2-(3-pyridin-2-ylphenyl)ethyl]azepan-4-yl]amino]-3-methyl-5-oxopentyl]carbamic acid (PubChem CID 69309720) has the molecular formula C26H36N4O4 and a molecular weight of 468.60 g/mol. Its IUPAC name is [(3S)-5-[[3-hydroxy-1-[2-(3-pyridin-2-ylphenyl)ethyl]azepan-4-yl]amino]-3-methyl-5-oxopentyl]carbamic acid.
| Compound Name | [(3S)-5-[[3-hydroxy-1-[2-(3-pyridin-2-ylphenyl)ethyl]azepan-4-yl]amino]-3-methyl-5-oxopentyl]carbamic acid |
|---|---|
| PubChem CID | 69309720 |
| Molecular Formula | C26H36N4O4 |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.27 |
| IUPAC Name | [(3S)-5-[[3-hydroxy-1-[2-(3-pyridin-2-ylphenyl)ethyl]azepan-4-yl]amino]-3-methyl-5-oxopentyl]carbamic acid |
| SMILES | C[C@@H](CCNC(=O)O)CC(=O)NC1CCCN(CCc2cccc(-c3ccccn3)c2)CC1O |
| InChI | InChI=1S/C26H36N4O4/c1-19(10-13-28-26(33)34)16-25(32)29-23-9-5-14-30(18-24(23)31)15-11-20-6-4-7-21(17-20)22-8-2-3-12-27-22/h2-4,6-8,12,17,19,23-24,28,31H,5,9-11,13-16,18H2,1H3,(H,29,32)(H,33,34)/t19-,23?,24?/m0/s1 |
| InChIKey | WEYHLHYIGMOCDP-HLJPNSHOSA-N |
| XLogP | 2.92 |
| TPSA | 114.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |