About dec-1-en-9-yn-5-one
dec-1-en-9-yn-5-one (PubChem CID 14265374) has the molecular formula C10H14O
and a molecular weight of 150.22 g/mol. Its IUPAC name is dec-1-en-9-yn-5-one.
Molecular Properties
| Compound Name | dec-1-en-9-yn-5-one |
| PubChem CID | 14265374 |
| Molecular Formula | C10H14O |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.10 |
| IUPAC Name | dec-1-en-9-yn-5-one |
| SMILES | C#CCCCC(=O)CCC=C |
| InChI | InChI=1S/C10H14O/c1-3-5-7-9-10(11)8-6-4-2/h1,4H,2,5-9H2 |
| InChIKey | PTYHWYWEYPWZFM-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze dec-1-en-9-yn-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dec-1-en-9-yn-5-one?
The IUPAC name of dec-1-en-9-yn-5-one (CID 14265374) is dec-1-en-9-yn-5-one.
What is the SMILES notation for dec-1-en-9-yn-5-one?
The canonical SMILES for dec-1-en-9-yn-5-one is C#CCCCC(=O)CCC=C.
What is the InChIKey of dec-1-en-9-yn-5-one?
The InChIKey is PTYHWYWEYPWZFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O/c1-3-5-7-9-10(11)8-6-4-2/h1,4H,2,5-9H2.
What are the key properties of dec-1-en-9-yn-5-one?
dec-1-en-9-yn-5-one has a molecular weight of 150.22 g/mol, XLogP of 2.33, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dec-1-en-9-yn-5-one is sourced from PubChem (CID 14265374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).