C21H18N4O2 — CID 142654333
2-[1-(4-methoxyphenyl)pyrrol-3-yl]-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-9-one (PubChem CID 142654333) has the molecular formula C21H18N4O2 and a molecular weight of 358.40 g/mol. Its IUPAC name is 2-[1-(4-methoxyphenyl)pyrrol-3-yl]-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-9-one.
| Compound Name | 2-[1-(4-methoxyphenyl)pyrrol-3-yl]-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-9-one |
|---|---|
| PubChem CID | 142654333 |
| Molecular Formula | C21H18N4O2 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | 2-[1-(4-methoxyphenyl)pyrrol-3-yl]-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-9-one |
| SMILES | COc1ccc(-n2ccc(-c3nc4cccc5c4n3CCNC5=O)c2)cc1 |
| InChI | InChI=1S/C21H18N4O2/c1-27-16-7-5-15(6-8-16)24-11-9-14(13-24)20-23-18-4-2-3-17-19(18)25(20)12-10-22-21(17)26/h2-9,11,13H,10,12H2,1H3,(H,22,26) |
| InChIKey | CYZDXDHGNSMJOS-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 61.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |