C21H21NO5 — CID 142654600
(E)-1-(3-cyclopentyloxy-4-methoxyphenyl)-3-(3-nitrophenyl)prop-2-en-1-one (PubChem CID 142654600) has the molecular formula C21H21NO5 and a molecular weight of 367.40 g/mol. Its IUPAC name is (E)-1-(3-cyclopentyloxy-4-methoxyphenyl)-3-(3-nitrophenyl)prop-2-en-1-one.
| Compound Name | (E)-1-(3-cyclopentyloxy-4-methoxyphenyl)-3-(3-nitrophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 142654600 |
| Molecular Formula | C21H21NO5 |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | (E)-1-(3-cyclopentyloxy-4-methoxyphenyl)-3-(3-nitrophenyl)prop-2-en-1-one |
| SMILES | COc1ccc(C(=O)/C=C/c2cccc([N+](=O)[O-])c2)cc1OC1CCCC1 |
| InChI | InChI=1S/C21H21NO5/c1-26-20-12-10-16(14-21(20)27-18-7-2-3-8-18)19(23)11-9-15-5-4-6-17(13-15)22(24)25/h4-6,9-14,18H,2-3,7-8H2,1H3/b11-9+ |
| InChIKey | MZLZSSJAEKHJGF-PKNBQFBNSA-N |
| XLogP | 4.82 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|