C21H20Cl2O3 — CID 142654603
(E)-1-(3-cyclopentyloxy-4-methoxyphenyl)-3-(2,6-dichlorophenyl)prop-2-en-1-one (PubChem CID 142654603) has the molecular formula C21H20Cl2O3 and a molecular weight of 391.29 g/mol. Its IUPAC name is (E)-1-(3-cyclopentyloxy-4-methoxyphenyl)-3-(2,6-dichlorophenyl)prop-2-en-1-one.
| Compound Name | (E)-1-(3-cyclopentyloxy-4-methoxyphenyl)-3-(2,6-dichlorophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 142654603 |
| Molecular Formula | C21H20Cl2O3 |
| Molecular Weight | 391.29 g/mol |
| Exact Mass | 390.08 |
| IUPAC Name | (E)-1-(3-cyclopentyloxy-4-methoxyphenyl)-3-(2,6-dichlorophenyl)prop-2-en-1-one |
| SMILES | COc1ccc(C(=O)/C=C/c2c(Cl)cccc2Cl)cc1OC1CCCC1 |
| InChI | InChI=1S/C21H20Cl2O3/c1-25-20-12-9-14(13-21(20)26-15-5-2-3-6-15)19(24)11-10-16-17(22)7-4-8-18(16)23/h4,7-13,15H,2-3,5-6H2,1H3/b11-10+ |
| InChIKey | KAHBAXJCBCMQBA-ZHACJKMWSA-N |
| XLogP | 6.22 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.29 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|