C10H8N4S — CID 142655955
6-pyridin-3-ylimidazo[2,1-b][1,3]thiazol-5-amine (PubChem CID 142655955) has the molecular formula C10H8N4S and a molecular weight of 216.27 g/mol. Its IUPAC name is 6-pyridin-3-ylimidazo[2,1-b][1,3]thiazol-5-amine.
| Compound Name | 6-pyridin-3-ylimidazo[2,1-b][1,3]thiazol-5-amine |
|---|---|
| PubChem CID | 142655955 |
| Molecular Formula | C10H8N4S |
| Molecular Weight | 216.27 g/mol |
| Exact Mass | 216.05 |
| IUPAC Name | 6-pyridin-3-ylimidazo[2,1-b][1,3]thiazol-5-amine |
| SMILES | Nc1c(-c2cccnc2)nc2sccn12 |
| InChI | InChI=1S/C10H8N4S/c11-9-8(7-2-1-3-12-6-7)13-10-14(9)4-5-15-10/h1-6H,11H2 |
| InChIKey | OTWFWEYDOWTTLE-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.27 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |