C14H28OSi — CID 142657121
1,2,3,3a,4,5,6,6a-octahydropentalen-1-yloxy-tert-butyl-dimethylsilane (PubChem CID 142657121) has the molecular formula C14H28OSi and a molecular weight of 240.46 g/mol. Its IUPAC name is 1,2,3,3a,4,5,6,6a-octahydropentalen-1-yloxy-tert-butyl-dimethylsilane.
| Compound Name | 1,2,3,3a,4,5,6,6a-octahydropentalen-1-yloxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 142657121 |
| Molecular Formula | C14H28OSi |
| Molecular Weight | 240.46 g/mol |
| Exact Mass | 240.19 |
| IUPAC Name | 1,2,3,3a,4,5,6,6a-octahydropentalen-1-yloxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OC1CCC2CCCC21 |
| InChI | InChI=1S/C14H28OSi/c1-14(2,3)16(4,5)15-13-10-9-11-7-6-8-12(11)13/h11-13H,6-10H2,1-5H3 |
| InChIKey | ACTUUYMEARCCMC-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.46 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|