C30H34N4O4 — CID 142661160
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(4-methyl-2-trityl-3H-1,2,4-triazol-5-yl)propanoic acid (PubChem CID 142661160) has the molecular formula C30H34N4O4 and a molecular weight of 514.63 g/mol. Its IUPAC name is (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(4-methyl-2-trityl-3H-1,2,4-triazol-5-yl)propanoic acid.
| Compound Name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(4-methyl-2-trityl-3H-1,2,4-triazol-5-yl)propanoic acid |
|---|---|
| PubChem CID | 142661160 |
| Molecular Formula | C30H34N4O4 |
| Molecular Weight | 514.63 g/mol |
| Exact Mass | 514.26 |
| IUPAC Name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(4-methyl-2-trityl-3H-1,2,4-triazol-5-yl)propanoic acid |
| SMILES | CN1CN(C(c2ccccc2)(c2ccccc2)c2ccccc2)N=C1C[C@H](NC(=O)OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C30H34N4O4/c1-29(2,3)38-28(37)31-25(27(35)36)20-26-32-34(21-33(26)4)30(22-14-8-5-9-15-22,23-16-10-6-11-17-23)24-18-12-7-13-19-24/h5-19,25H,20-21H2,1-4H3,(H,31,37)(H,35,36)/t25-/m0/s1 |
| InChIKey | TZYQACVQDYYDJJ-VWLOTQADSA-N |
| XLogP | 4.86 |
| TPSA | 94.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.63 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|