C29H35F3IN3O5 — CID 142662214
[1-[[(2S,3R)-3-hydroxy-4-[(3-iodophenyl)methylamino]-1-phenylbutan-2-yl]amino]-1,5-dioxo-5-piperidin-1-ylpentan-2-yl] 2,2,2-trifluoroacetate (PubChem CID 142662214) has the molecular formula C29H35F3IN3O5 and a molecular weight of 689.51 g/mol. Its IUPAC name is [1-[[(2S,3R)-3-hydroxy-4-[(3-iodophenyl)methylamino]-1-phenylbutan-2-yl]amino]-1,5-dioxo-5-piperidin-1-ylpentan-2-yl] 2,2,2-trifluoroacetate.
| Compound Name | [1-[[(2S,3R)-3-hydroxy-4-[(3-iodophenyl)methylamino]-1-phenylbutan-2-yl]amino]-1,5-dioxo-5-piperidin-1-ylpentan-2-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 142662214 |
| Molecular Formula | C29H35F3IN3O5 |
| Molecular Weight | 689.51 g/mol |
| Exact Mass | 689.16 |
| IUPAC Name | [1-[[(2S,3R)-3-hydroxy-4-[(3-iodophenyl)methylamino]-1-phenylbutan-2-yl]amino]-1,5-dioxo-5-piperidin-1-ylpentan-2-yl] 2,2,2-trifluoroacetate |
| SMILES | O=C(N[C@@H](Cc1ccccc1)[C@H](O)CNCc1cccc(I)c1)C(CCC(=O)N1CCCCC1)OC(=O)C(F)(F)F |
| InChI | InChI=1S/C29H35F3IN3O5/c30-29(31,32)28(40)41-25(12-13-26(38)36-14-5-2-6-15-36)27(39)35-23(17-20-8-3-1-4-9-20)24(37)19-34-18-21-10-7-11-22(33)16-21/h1,3-4,7-11,16,23-25,34,37H,2,5-6,12-15,17-19H2,(H,35,39)/t23-,24+,25?/m0/s1 |
| InChIKey | OGNDSTUJCLJMNX-ZXABPTRBSA-N |
| XLogP | 3.74 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.51 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|