C27H36IN3O3 — CID 68610611
N-[(2S,3S)-3-hydroxy-4-[(3-iodophenyl)methylamino]-1-phenylbutan-2-yl]-5-oxo-5-piperidin-1-ylpentanamide (PubChem CID 68610611) has the molecular formula C27H36IN3O3 and a molecular weight of 577.51 g/mol. Its IUPAC name is N-[(2S,3S)-3-hydroxy-4-[(3-iodophenyl)methylamino]-1-phenylbutan-2-yl]-5-oxo-5-piperidin-1-ylpentanamide.
| Compound Name | N-[(2S,3S)-3-hydroxy-4-[(3-iodophenyl)methylamino]-1-phenylbutan-2-yl]-5-oxo-5-piperidin-1-ylpentanamide |
|---|---|
| PubChem CID | 68610611 |
| Molecular Formula | C27H36IN3O3 |
| Molecular Weight | 577.51 g/mol |
| Exact Mass | 577.18 |
| IUPAC Name | N-[(2S,3S)-3-hydroxy-4-[(3-iodophenyl)methylamino]-1-phenylbutan-2-yl]-5-oxo-5-piperidin-1-ylpentanamide |
| SMILES | O=C(CCCC(=O)N1CCCCC1)N[C@@H](Cc1ccccc1)[C@@H](O)CNCc1cccc(I)c1 |
| InChI | InChI=1S/C27H36IN3O3/c28-23-12-7-11-22(17-23)19-29-20-25(32)24(18-21-9-3-1-4-10-21)30-26(33)13-8-14-27(34)31-15-5-2-6-16-31/h1,3-4,7,9-12,17,24-25,29,32H,2,5-6,8,13-16,18-20H2,(H,30,33)/t24-,25-/m0/s1 |
| InChIKey | LHIBWYNYKYRRBX-DQEYMECFSA-N |
| XLogP | 3.65 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.51 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|