C33H33F2IN2O3 — CID 68662834
N-[(2S,3S)-1-(3,5-difluorophenyl)-3-hydroxy-4-[(3-iodophenyl)methylamino]butan-2-yl]-4-(4-phenoxyphenyl)butanamide (PubChem CID 68662834) has the molecular formula C33H33F2IN2O3 and a molecular weight of 670.54 g/mol. Its IUPAC name is N-[(2S,3S)-1-(3,5-difluorophenyl)-3-hydroxy-4-[(3-iodophenyl)methylamino]butan-2-yl]-4-(4-phenoxyphenyl)butanamide.
| Compound Name | N-[(2S,3S)-1-(3,5-difluorophenyl)-3-hydroxy-4-[(3-iodophenyl)methylamino]butan-2-yl]-4-(4-phenoxyphenyl)butanamide |
|---|---|
| PubChem CID | 68662834 |
| Molecular Formula | C33H33F2IN2O3 |
| Molecular Weight | 670.54 g/mol |
| Exact Mass | 670.15 |
| IUPAC Name | N-[(2S,3S)-1-(3,5-difluorophenyl)-3-hydroxy-4-[(3-iodophenyl)methylamino]butan-2-yl]-4-(4-phenoxyphenyl)butanamide |
| SMILES | O=C(CCCc1ccc(Oc2ccccc2)cc1)N[C@@H](Cc1cc(F)cc(F)c1)[C@@H](O)CNCc1cccc(I)c1 |
| InChI | InChI=1S/C33H33F2IN2O3/c34-26-16-25(17-27(35)20-26)19-31(32(39)22-37-21-24-7-4-8-28(36)18-24)38-33(40)11-5-6-23-12-14-30(15-13-23)41-29-9-2-1-3-10-29/h1-4,7-10,12-18,20,31-32,37,39H,5-6,11,19,21-22H2,(H,38,40)/t31-,32-/m0/s1 |
| InChIKey | MTUNROCUZGDWMJ-ACHIHNKUSA-N |
| XLogP | 6.56 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.54 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|