C23H21F5N2O — CID 142662278
(2R,3S)-3-amino-4-(3,5-difluorophenyl)-1-[[3-(2,3,4-trifluorophenyl)phenyl]methylamino]butan-2-ol (PubChem CID 142662278) has the molecular formula C23H21F5N2O and a molecular weight of 436.42 g/mol. Its IUPAC name is (2R,3S)-3-amino-4-(3,5-difluorophenyl)-1-[[3-(2,3,4-trifluorophenyl)phenyl]methylamino]butan-2-ol.
| Compound Name | (2R,3S)-3-amino-4-(3,5-difluorophenyl)-1-[[3-(2,3,4-trifluorophenyl)phenyl]methylamino]butan-2-ol |
|---|---|
| PubChem CID | 142662278 |
| Molecular Formula | C23H21F5N2O |
| Molecular Weight | 436.42 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | (2R,3S)-3-amino-4-(3,5-difluorophenyl)-1-[[3-(2,3,4-trifluorophenyl)phenyl]methylamino]butan-2-ol |
| SMILES | N[C@@H](Cc1cc(F)cc(F)c1)[C@H](O)CNCc1cccc(-c2ccc(F)c(F)c2F)c1 |
| InChI | InChI=1S/C23H21F5N2O/c24-16-7-14(8-17(25)10-16)9-20(29)21(31)12-30-11-13-2-1-3-15(6-13)18-4-5-19(26)23(28)22(18)27/h1-8,10,20-21,30-31H,9,11-12,29H2/t20-,21+/m0/s1 |
| InChIKey | DXOZPBPDWIZAPP-LEWJYISDSA-N |
| XLogP | 4.07 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.42 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|