C22H16F6N2O2 — CID 142666093
6-[[2-[2,4-bis(trifluoromethyl)phenyl]-3,4-dihydro-2H-chromen-6-yl]oxy]pyridin-3-amine (PubChem CID 142666093) has the molecular formula C22H16F6N2O2 and a molecular weight of 454.37 g/mol. Its IUPAC name is 6-[[2-[2,4-bis(trifluoromethyl)phenyl]-3,4-dihydro-2H-chromen-6-yl]oxy]pyridin-3-amine.
| Compound Name | 6-[[2-[2,4-bis(trifluoromethyl)phenyl]-3,4-dihydro-2H-chromen-6-yl]oxy]pyridin-3-amine |
|---|---|
| PubChem CID | 142666093 |
| Molecular Formula | C22H16F6N2O2 |
| Molecular Weight | 454.37 g/mol |
| Exact Mass | 454.11 |
| IUPAC Name | 6-[[2-[2,4-bis(trifluoromethyl)phenyl]-3,4-dihydro-2H-chromen-6-yl]oxy]pyridin-3-amine |
| SMILES | Nc1ccc(Oc2ccc3c(c2)CCC(c2ccc(C(F)(F)F)cc2C(F)(F)F)O3)nc1 |
| InChI | InChI=1S/C22H16F6N2O2/c23-21(24,25)13-2-5-16(17(10-13)22(26,27)28)19-6-1-12-9-15(4-7-18(12)32-19)31-20-8-3-14(29)11-30-20/h2-5,7-11,19H,1,6,29H2 |
| InChIKey | PNGXLIBNHVVOKW-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.37 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_OC_no_alk_A(8)', 'substructure': 'N/A'} |
|---|