C16H19ClFN3O — CID 142668705
4-[4-[[5-(chloromethyl)-4-methylimidazol-1-yl]methyl]-3-fluorophenyl]morpholine (PubChem CID 142668705) has the molecular formula C16H19ClFN3O and a molecular weight of 323.80 g/mol. Its IUPAC name is 4-[4-[[5-(chloromethyl)-4-methylimidazol-1-yl]methyl]-3-fluorophenyl]morpholine.
| Compound Name | 4-[4-[[5-(chloromethyl)-4-methylimidazol-1-yl]methyl]-3-fluorophenyl]morpholine |
|---|---|
| PubChem CID | 142668705 |
| Molecular Formula | C16H19ClFN3O |
| Molecular Weight | 323.80 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | 4-[4-[[5-(chloromethyl)-4-methylimidazol-1-yl]methyl]-3-fluorophenyl]morpholine |
| SMILES | Cc1ncn(Cc2ccc(N3CCOCC3)cc2F)c1CCl |
| InChI | InChI=1S/C16H19ClFN3O/c1-12-16(9-17)21(11-19-12)10-13-2-3-14(8-15(13)18)20-4-6-22-7-5-20/h2-3,8,11H,4-7,9-10H2,1H3 |
| InChIKey | JLXNDFDWSPVTMP-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.80 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|