C30H24ClF2NO3 — CID 142671136
(2-chloro-5-nitrophenyl)-[4-[2,5-difluoro-4-(4-pentylphenyl)phenyl]phenyl]methanone (PubChem CID 142671136) has the molecular formula C30H24ClF2NO3 and a molecular weight of 519.98 g/mol. Its IUPAC name is (2-chloro-5-nitrophenyl)-[4-[2,5-difluoro-4-(4-pentylphenyl)phenyl]phenyl]methanone.
| Compound Name | (2-chloro-5-nitrophenyl)-[4-[2,5-difluoro-4-(4-pentylphenyl)phenyl]phenyl]methanone |
|---|---|
| PubChem CID | 142671136 |
| Molecular Formula | C30H24ClF2NO3 |
| Molecular Weight | 519.98 g/mol |
| Exact Mass | 519.14 |
| IUPAC Name | (2-chloro-5-nitrophenyl)-[4-[2,5-difluoro-4-(4-pentylphenyl)phenyl]phenyl]methanone |
| SMILES | CCCCCc1ccc(-c2cc(F)c(-c3ccc(C(=O)c4cc([N+](=O)[O-])ccc4Cl)cc3)cc2F)cc1 |
| InChI | InChI=1S/C30H24ClF2NO3/c1-2-3-4-5-19-6-8-20(9-7-19)24-17-29(33)25(18-28(24)32)21-10-12-22(13-11-21)30(35)26-16-23(34(36)37)14-15-27(26)31/h6-18H,2-5H2,1H3 |
| InChIKey | DRBSVTDXWZCIDX-UHFFFAOYSA-N |
| XLogP | 8.82 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.98 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|