C13H14N2O4 — CID 142671782
(2R)-5,6-dioxo-4-[(1R)-1-phenylethyl]piperazine-2-carboxylic acid (PubChem CID 142671782) has the molecular formula C13H14N2O4 and a molecular weight of 262.26 g/mol. Its IUPAC name is (2R)-5,6-dioxo-4-[(1R)-1-phenylethyl]piperazine-2-carboxylic acid.
| Compound Name | (2R)-5,6-dioxo-4-[(1R)-1-phenylethyl]piperazine-2-carboxylic acid |
|---|---|
| PubChem CID | 142671782 |
| Molecular Formula | C13H14N2O4 |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | (2R)-5,6-dioxo-4-[(1R)-1-phenylethyl]piperazine-2-carboxylic acid |
| SMILES | C[C@H](c1ccccc1)N1C[C@H](C(=O)O)NC(=O)C1=O |
| InChI | InChI=1S/C13H14N2O4/c1-8(9-5-3-2-4-6-9)15-7-10(13(18)19)14-11(16)12(15)17/h2-6,8,10H,7H2,1H3,(H,14,16)(H,18,19)/t8-,10-/m1/s1 |
| InChIKey | RHHJYVQAMNEUHV-PSASIEDQSA-N |
| XLogP | 0.16 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|