C13H14O3 — CID 142674424
2-[2-(2-methylphenyl)ethynyl]oxolane-3,4-diol (PubChem CID 142674424) has the molecular formula C13H14O3 and a molecular weight of 218.25 g/mol. Its IUPAC name is 2-[2-(2-methylphenyl)ethynyl]oxolane-3,4-diol.
| Compound Name | 2-[2-(2-methylphenyl)ethynyl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 142674424 |
| Molecular Formula | C13H14O3 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | 2-[2-(2-methylphenyl)ethynyl]oxolane-3,4-diol |
| SMILES | Cc1ccccc1C#CC1OCC(O)C1O |
| InChI | InChI=1S/C13H14O3/c1-9-4-2-3-5-10(9)6-7-12-13(15)11(14)8-16-12/h2-5,11-15H,8H2,1H3 |
| InChIKey | ATMVTZGPCXBVMH-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|