C10H18BrNO — CID 142675199
2-bromo-1-(2,2,4-trimethylazetidin-1-yl)butan-1-one (PubChem CID 142675199) has the molecular formula C10H18BrNO and a molecular weight of 248.16 g/mol. Its IUPAC name is 2-bromo-1-(2,2,4-trimethylazetidin-1-yl)butan-1-one.
| Compound Name | 2-bromo-1-(2,2,4-trimethylazetidin-1-yl)butan-1-one |
|---|---|
| PubChem CID | 142675199 |
| Molecular Formula | C10H18BrNO |
| Molecular Weight | 248.16 g/mol |
| Exact Mass | 247.06 |
| IUPAC Name | 2-bromo-1-(2,2,4-trimethylazetidin-1-yl)butan-1-one |
| SMILES | CCC(Br)C(=O)N1C(C)CC1(C)C |
| InChI | InChI=1S/C10H18BrNO/c1-5-8(11)9(13)12-7(2)6-10(12,3)4/h7-8H,5-6H2,1-4H3 |
| InChIKey | ZQNSMKLARWUTOJ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.16 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|