About 1H-perimidine-2-carbonyl fluoride
1H-perimidine-2-carbonyl fluoride (PubChem CID 142675319) has the molecular formula C12H7FN2O
and a molecular weight of 214.20 g/mol. Its IUPAC name is 1H-perimidine-2-carbonyl fluoride.
Molecular Properties
| Compound Name | 1H-perimidine-2-carbonyl fluoride |
| PubChem CID | 142675319 |
| Molecular Formula | C12H7FN2O |
| Molecular Weight | 214.20 g/mol |
| Exact Mass | 214.05 |
| IUPAC Name | 1H-perimidine-2-carbonyl fluoride |
| SMILES | O=C(F)C1=Nc2cccc3cccc(c23)N1 |
| InChI | InChI=1S/C12H7FN2O/c13-11(16)12-14-8-5-1-3-7-4-2-6-9(15-12)10(7)8/h1-6H,(H,14,15) |
| InChIKey | JYYCSXYERHOUNR-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.20 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'naphth_amino_A(25)', 'substructure': 'N/A'}, {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 1H-perimidine-2-carbonyl fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-perimidine-2-carbonyl fluoride?
The IUPAC name of 1H-perimidine-2-carbonyl fluoride (CID 142675319) is 1H-perimidine-2-carbonyl fluoride.
What is the SMILES notation for 1H-perimidine-2-carbonyl fluoride?
The canonical SMILES for 1H-perimidine-2-carbonyl fluoride is O=C(F)C1=Nc2cccc3cccc(c23)N1.
What is the InChIKey of 1H-perimidine-2-carbonyl fluoride?
The InChIKey is JYYCSXYERHOUNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7FN2O/c13-11(16)12-14-8-5-1-3-7-4-2-6-9(15-12)10(7)8/h1-6H,(H,14,15).
What are the key properties of 1H-perimidine-2-carbonyl fluoride?
1H-perimidine-2-carbonyl fluoride has a molecular weight of 214.20 g/mol, XLogP of 2.79, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-perimidine-2-carbonyl fluoride is sourced from PubChem (CID 142675319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).