C16H24O2 — CID 142675602
5-hexyl-5-methoxy-3,4-dihydro-2H-inden-1-one (PubChem CID 142675602) has the molecular formula C16H24O2 and a molecular weight of 248.37 g/mol. Its IUPAC name is 5-hexyl-5-methoxy-3,4-dihydro-2H-inden-1-one.
| Compound Name | 5-hexyl-5-methoxy-3,4-dihydro-2H-inden-1-one |
|---|---|
| PubChem CID | 142675602 |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | 5-hexyl-5-methoxy-3,4-dihydro-2H-inden-1-one |
| SMILES | CCCCCCC1(OC)C=CC2=C(CCC2=O)C1 |
| InChI | InChI=1S/C16H24O2/c1-3-4-5-6-10-16(18-2)11-9-14-13(12-16)7-8-15(14)17/h9,11H,3-8,10,12H2,1-2H3 |
| InChIKey | WYGJIZBWRJJHCD-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|