C18H17N3O3 — CID 142675624
2-(6-hydroxy-4-phenyl-2H-benzotriazol-5-yl)ethyl 2-methylprop-2-enoate (PubChem CID 142675624) has the molecular formula C18H17N3O3 and a molecular weight of 323.35 g/mol. Its IUPAC name is 2-(6-hydroxy-4-phenyl-2H-benzotriazol-5-yl)ethyl 2-methylprop-2-enoate.
| Compound Name | 2-(6-hydroxy-4-phenyl-2H-benzotriazol-5-yl)ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 142675624 |
| Molecular Formula | C18H17N3O3 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | 2-(6-hydroxy-4-phenyl-2H-benzotriazol-5-yl)ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCc1c(O)cc2n[nH]nc2c1-c1ccccc1 |
| InChI | InChI=1S/C18H17N3O3/c1-11(2)18(23)24-9-8-13-15(22)10-14-17(20-21-19-14)16(13)12-6-4-3-5-7-12/h3-7,10,22H,1,8-9H2,2H3,(H,19,20,21) |
| InChIKey | RMFXONAGVSFBSE-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|